C19H28N8O2S — CID 121483656
8-(1-ethyl-5-methylpyrazol-4-yl)-N-(1-ethylsulfonylpiperidin-3-yl)-9-methylpurin-6-amine (PubChem CID 121483656) has the molecular formula C19H28N8O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is 8-(1-ethyl-5-methylpyrazol-4-yl)-N-(1-ethylsulfonylpiperidin-3-yl)-9-methylpurin-6-amine.
| Compound Name | 8-(1-ethyl-5-methylpyrazol-4-yl)-N-(1-ethylsulfonylpiperidin-3-yl)-9-methylpurin-6-amine |
|---|---|
| PubChem CID | 121483656 |
| Molecular Formula | C19H28N8O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 8-(1-ethyl-5-methylpyrazol-4-yl)-N-(1-ethylsulfonylpiperidin-3-yl)-9-methylpurin-6-amine |
| SMILES | CCn1ncc(-c2nc3c(NC4CCCN(S(=O)(=O)CC)C4)ncnc3n2C)c1C |
| InChI | InChI=1S/C19H28N8O2S/c1-5-27-13(3)15(10-22-27)18-24-16-17(20-12-21-19(16)25(18)4)23-14-8-7-9-26(11-14)30(28,29)6-2/h10,12,14H,5-9,11H2,1-4H3,(H,20,21,23) |
| InChIKey | IBYIBXHPAHZZDG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 110.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |