C17H15F4N5O4S — CID 90163871
2-[4-[[5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-yl]amino]pyrazol-1-yl]ethyl methanesulfonate (PubChem CID 90163871) has the molecular formula C17H15F4N5O4S and a molecular weight of 461.40 g/mol. Its IUPAC name is 2-[4-[[5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-yl]amino]pyrazol-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[4-[[5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-yl]amino]pyrazol-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 90163871 |
| Molecular Formula | C17H15F4N5O4S |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 2-[4-[[5-[(2,3,5,6-tetrafluorophenyl)methoxy]pyrimidin-2-yl]amino]pyrazol-1-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCn1cc(Nc2ncc(OCc3c(F)c(F)cc(F)c3F)cn2)cn1 |
| InChI | InChI=1S/C17H15F4N5O4S/c1-31(27,28)30-3-2-26-8-10(5-24-26)25-17-22-6-11(7-23-17)29-9-12-15(20)13(18)4-14(19)16(12)21/h4-8H,2-3,9H2,1H3,(H,22,23,25) |
| InChIKey | GZGRPLVQEZVRSI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|