C15H23NO2S — CID 90164965
1-(2-tert-butylphenyl)sulfonyl-2,2-dimethylazetidine (PubChem CID 90164965) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)sulfonyl-2,2-dimethylazetidine.
| Compound Name | 1-(2-tert-butylphenyl)sulfonyl-2,2-dimethylazetidine |
|---|---|
| PubChem CID | 90164965 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 1-(2-tert-butylphenyl)sulfonyl-2,2-dimethylazetidine |
| SMILES | CC(C)(C)c1ccccc1S(=O)(=O)N1CCC1(C)C |
| InChI | InChI=1S/C15H23NO2S/c1-14(2,3)12-8-6-7-9-13(12)19(17,18)16-11-10-15(16,4)5/h6-9H,10-11H2,1-5H3 |
| InChIKey | OCHAFWRQHKHFSA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |