C13H20N2O2S — CID 63220011
[2-(2,2-dimethylpyrrolidin-1-yl)sulfonylphenyl]methanamine (PubChem CID 63220011) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is [2-(2,2-dimethylpyrrolidin-1-yl)sulfonylphenyl]methanamine.
| Compound Name | [2-(2,2-dimethylpyrrolidin-1-yl)sulfonylphenyl]methanamine |
|---|---|
| PubChem CID | 63220011 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | [2-(2,2-dimethylpyrrolidin-1-yl)sulfonylphenyl]methanamine |
| SMILES | CC1(C)CCCN1S(=O)(=O)c1ccccc1CN |
| InChI | InChI=1S/C13H20N2O2S/c1-13(2)8-5-9-15(13)18(16,17)12-7-4-3-6-11(12)10-14/h3-4,6-7H,5,8-10,14H2,1-2H3 |
| InChIKey | NXYNUTVQNCADPT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |