C13H20N2O2S — CID 63216408
2-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-3-methylaniline (PubChem CID 63216408) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-3-methylaniline.
| Compound Name | 2-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-3-methylaniline |
|---|---|
| PubChem CID | 63216408 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-(2,2-dimethylpyrrolidin-1-yl)sulfonyl-3-methylaniline |
| SMILES | Cc1cccc(N)c1S(=O)(=O)N1CCCC1(C)C |
| InChI | InChI=1S/C13H20N2O2S/c1-10-6-4-7-11(14)12(10)18(16,17)15-9-5-8-13(15,2)3/h4,6-7H,5,8-9,14H2,1-3H3 |
| InChIKey | GQLKVJMEMKLGMZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|