C18H20N4O — CID 9016945
N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-ethyl-2-methylbenzimidazole-5-carboxamide (PubChem CID 9016945) has the molecular formula C18H20N4O and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-ethyl-2-methylbenzimidazole-5-carboxamide.
| Compound Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 9016945 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)N/N=C3/C[C@@H]4C=CC[C@@H]34)ccc21 |
| InChI | InChI=1S/C18H20N4O/c1-3-22-11(2)19-16-10-13(7-8-17(16)22)18(23)21-20-15-9-12-5-4-6-14(12)15/h4-5,7-8,10,12,14H,3,6,9H2,1-2H3,(H,21,23)/b20-15-/t12-,14+/m0/s1 |
| InChIKey | DKFXDXDGSLXSJS-VJJRLMPCSA-N |
| XLogP | 3.05 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|