C14H18F3OSi — CID 90172123
CID 90172123 (PubChem CID 90172123) has the molecular formula C14H18F3OSi and a molecular weight of 287.38 g/mol.
| Compound Name | CID 90172123 |
|---|---|
| PubChem CID | 90172123 |
| Molecular Formula | C14H18F3OSi |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | — |
| SMILES | CCC(CC)(CCc1cccc(C(F)(F)F)c1)O[Si] |
| InChI | InChI=1S/C14H18F3OSi/c1-3-13(4-2,18-19)9-8-11-6-5-7-12(10-11)14(15,16)17/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | YICJDSLGOPQPFF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|