C12H15F5OSi — CID 90173357
benzyl-(2,2-difluoroethyl)-ethyl-(trifluoromethoxy)silane (PubChem CID 90173357) has the molecular formula C12H15F5OSi and a molecular weight of 298.33 g/mol. Its IUPAC name is benzyl-(2,2-difluoroethyl)-ethyl-(trifluoromethoxy)silane.
| Compound Name | benzyl-(2,2-difluoroethyl)-ethyl-(trifluoromethoxy)silane |
|---|---|
| PubChem CID | 90173357 |
| Molecular Formula | C12H15F5OSi |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | benzyl-(2,2-difluoroethyl)-ethyl-(trifluoromethoxy)silane |
| SMILES | CC[Si](Cc1ccccc1)(CC(F)F)OC(F)(F)F |
| InChI | InChI=1S/C12H15F5OSi/c1-2-19(9-11(13)14,18-12(15,16)17)8-10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3 |
| InChIKey | QSHWHLDERWHXDS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|