C19H20F6O3Si — CID 90174042
[4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-dimethoxy-propan-2-yloxysilane (PubChem CID 90174042) has the molecular formula C19H20F6O3Si and a molecular weight of 438.44 g/mol. Its IUPAC name is [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-dimethoxy-propan-2-yloxysilane.
| Compound Name | [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-dimethoxy-propan-2-yloxysilane |
|---|---|
| PubChem CID | 90174042 |
| Molecular Formula | C19H20F6O3Si |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [4-[3,5-bis(trifluoromethyl)phenyl]phenyl]-dimethoxy-propan-2-yloxysilane |
| SMILES | CO[Si](OC)(OC(C)C)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H20F6O3Si/c1-12(2)28-29(26-3,27-4)17-7-5-13(6-8-17)14-9-15(18(20,21)22)11-16(10-14)19(23,24)25/h5-12H,1-4H3 |
| InChIKey | IPSVPQGZLXBWRO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|