C23H28N4O12S2 — CID 90175777
(3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-(4-formamidophenyl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 90175777) has the molecular formula C23H28N4O12S2 and a molecular weight of 616.63 g/mol. Its IUPAC name is (3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-(4-formamidophenyl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-(4-formamidophenyl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90175777 |
| Molecular Formula | C23H28N4O12S2 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | (3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-(4-formamidophenyl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | O=CNc1ccc(CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CSSCCOC=O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H28N4O12S2/c28-11-24-14-3-1-13(2-4-14)7-18(30)25-15(8-19(31)32)21(35)26-16(9-20(33)34)22(36)27-17(23(37)38)10-41-40-6-5-39-12-29/h1-4,11-12,15-17H,5-10H2,(H,24,28)(H,25,30)(H,26,35)(H,27,36)(H,31,32)(H,33,34)(H,37,38)/t15-,16-,17-/m0/s1 |
| InChIKey | IRBIYXLWAIQBQJ-ULQDDVLXSA-N |
| XLogP | -1.16 |
| TPSA | 254.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|