C14H21N3O10S2 — CID 90195833
(2S)-2-amino-4-[[(1S)-1-carboxy-3-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-3-oxopropyl]amino]-4-oxobutanoic acid (PubChem CID 90195833) has the molecular formula C14H21N3O10S2 and a molecular weight of 455.47 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(1S)-1-carboxy-3-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-3-oxopropyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[[(1S)-1-carboxy-3-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-3-oxopropyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90195833 |
| Molecular Formula | C14H21N3O10S2 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.07 |
| IUPAC Name | (2S)-2-amino-4-[[(1S)-1-carboxy-3-[[(1R)-1-carboxy-2-(2-formyloxyethyldisulfanyl)ethyl]amino]-3-oxopropyl]amino]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)N[C@@H](CC(=O)N[C@@H](CSSCCOC=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H21N3O10S2/c15-7(12(21)22)3-10(19)16-8(13(23)24)4-11(20)17-9(14(25)26)5-29-28-2-1-27-6-18/h6-9H,1-5,15H2,(H,16,19)(H,17,20)(H,21,22)(H,23,24)(H,25,26)/t7-,8-,9-/m0/s1 |
| InChIKey | DRBVDJNHRAVGBA-CIUDSAMLSA-N |
| XLogP | -2.13 |
| TPSA | 222.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|