C21H26N4O10S — CID 90175642
(3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4-oxobutanoic acid (PubChem CID 90175642) has the molecular formula C21H26N4O10S and a molecular weight of 526.52 g/mol. Its IUPAC name is (3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 90175642 |
| Molecular Formula | C21H26N4O10S |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | (3S)-4-[[(2S)-3-carboxy-1-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-1-oxopropan-2-yl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4-oxobutanoic acid |
| SMILES | O=CNCc1ccc(CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CS)C(=O)O)cc1 |
| InChI | InChI=1S/C21H26N4O10S/c26-10-22-8-12-3-1-11(2-4-12)5-16(27)23-13(6-17(28)29)19(32)24-14(7-18(30)31)20(33)25-15(9-36)21(34)35/h1-4,10,13-15,36H,5-9H2,(H,22,26)(H,23,27)(H,24,32)(H,25,33)(H,28,29)(H,30,31)(H,34,35)/t13-,14-,15-/m0/s1 |
| InChIKey | DPQPCBIBNDUGIF-KKUMJFAQSA-N |
| XLogP | -2.11 |
| TPSA | 228.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|