C27H31N3O8S — CID 157478217
(3S,6R)-6-benzyl-7-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4,7-dioxoheptanoic acid (PubChem CID 157478217) has the molecular formula C27H31N3O8S and a molecular weight of 557.63 g/mol. Its IUPAC name is (3S,6R)-6-benzyl-7-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4,7-dioxoheptanoic acid.
| Compound Name | (3S,6R)-6-benzyl-7-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4,7-dioxoheptanoic acid |
|---|---|
| PubChem CID | 157478217 |
| Molecular Formula | C27H31N3O8S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | (3S,6R)-6-benzyl-7-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-3-[[2-[4-(formamidomethyl)phenyl]acetyl]amino]-4,7-dioxoheptanoic acid |
| SMILES | O=CNCc1ccc(CC(=O)N[C@@H](CC(=O)O)C(=O)C[C@@H](Cc2ccccc2)C(=O)N[C@@H](CS)C(=O)O)cc1 |
| InChI | InChI=1S/C27H31N3O8S/c31-16-28-14-19-8-6-18(7-9-19)11-24(33)29-21(13-25(34)35)23(32)12-20(10-17-4-2-1-3-5-17)26(36)30-22(15-39)27(37)38/h1-9,16,20-22,39H,10-15H2,(H,28,31)(H,29,33)(H,30,36)(H,34,35)(H,37,38)/t20-,21+,22+/m1/s1 |
| InChIKey | GZWQHOLORQDJFC-FSSWDIPSSA-N |
| XLogP | 0.75 |
| TPSA | 178.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|