C36H46N4O3 — CID 90178815
benzyl N-[2-[(2S)-1-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]butan-2-yl]oxypropan-2-yl]carbamate (PubChem CID 90178815) has the molecular formula C36H46N4O3 and a molecular weight of 582.79 g/mol. Its IUPAC name is benzyl N-[2-[(2S)-1-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]butan-2-yl]oxypropan-2-yl]carbamate.
| Compound Name | benzyl N-[2-[(2S)-1-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]butan-2-yl]oxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 90178815 |
| Molecular Formula | C36H46N4O3 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.36 |
| IUPAC Name | benzyl N-[2-[(2S)-1-[[(1R)-1-(1-benzyl-4-phenylimidazol-2-yl)-2,2-dimethylpropyl]amino]butan-2-yl]oxypropan-2-yl]carbamate |
| SMILES | CC[C@@H](CN[C@@H](c1nc(-c2ccccc2)cn1Cc1ccccc1)C(C)(C)C)OC(C)(C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H46N4O3/c1-7-30(43-36(5,6)39-34(41)42-26-28-19-13-9-14-20-28)23-37-32(35(2,3)4)33-38-31(29-21-15-10-16-22-29)25-40(33)24-27-17-11-8-12-18-27/h8-22,25,30,32,37H,7,23-24,26H2,1-6H3,(H,39,41)/t30-,32-/m0/s1 |
| InChIKey | URVCNGWAFAFNKI-CDZUIXILSA-N |
| XLogP | 7.73 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|