C15H12N2O4S — CID 90178873
methyl 3-[5-(5-oxo-2-sulfanylideneimidazolidin-4-yl)furan-2-yl]benzoate (PubChem CID 90178873) has the molecular formula C15H12N2O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is methyl 3-[5-(5-oxo-2-sulfanylideneimidazolidin-4-yl)furan-2-yl]benzoate.
| Compound Name | methyl 3-[5-(5-oxo-2-sulfanylideneimidazolidin-4-yl)furan-2-yl]benzoate |
|---|---|
| PubChem CID | 90178873 |
| Molecular Formula | C15H12N2O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | methyl 3-[5-(5-oxo-2-sulfanylideneimidazolidin-4-yl)furan-2-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2ccc(C3NC(=S)NC3=O)o2)c1 |
| InChI | InChI=1S/C15H12N2O4S/c1-20-14(19)9-4-2-3-8(7-9)10-5-6-11(21-10)12-13(18)17-15(22)16-12/h2-7,12H,1H3,(H2,16,17,18,22) |
| InChIKey | FSOHKJMXZTURGL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|