C20H34O4S2 — CID 90179401
3-O-ethyl 4-O-(2-ethyl-5-methyl-5-sulfanylhexyl) 1-methyl-7-thiabicyclo[4.1.0]heptane-3,4-dicarboxylate (PubChem CID 90179401) has the molecular formula C20H34O4S2 and a molecular weight of 402.62 g/mol. Its IUPAC name is 3-O-ethyl 4-O-(2-ethyl-5-methyl-5-sulfanylhexyl) 1-methyl-7-thiabicyclo[4.1.0]heptane-3,4-dicarboxylate.
| Compound Name | 3-O-ethyl 4-O-(2-ethyl-5-methyl-5-sulfanylhexyl) 1-methyl-7-thiabicyclo[4.1.0]heptane-3,4-dicarboxylate |
|---|---|
| PubChem CID | 90179401 |
| Molecular Formula | C20H34O4S2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 3-O-ethyl 4-O-(2-ethyl-5-methyl-5-sulfanylhexyl) 1-methyl-7-thiabicyclo[4.1.0]heptane-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1CC2(C)SC2CC1C(=O)OCC(CC)CCC(C)(C)S |
| InChI | InChI=1S/C20H34O4S2/c1-6-13(8-9-19(3,4)25)12-24-17(21)14-10-16-20(5,26-16)11-15(14)18(22)23-7-2/h13-16,25H,6-12H2,1-5H3 |
| InChIKey | SNTAEQZWWLJPSJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|