C20H14Cl2Zr2-2 — CID 90184896
2-[1,1-dichloro-2-(1H-inden-1-id-2-yl)ethyl]-1H-inden-1-ide;zirconium (PubChem CID 90184896) has the molecular formula C20H14Cl2Zr2-2 and a molecular weight of 507.69 g/mol. Its IUPAC name is 2-[1,1-dichloro-2-(1H-inden-1-id-2-yl)ethyl]-1H-inden-1-ide;zirconium.
| Compound Name | 2-[1,1-dichloro-2-(1H-inden-1-id-2-yl)ethyl]-1H-inden-1-ide;zirconium |
|---|---|
| PubChem CID | 90184896 |
| Molecular Formula | C20H14Cl2Zr2-2 |
| Molecular Weight | 507.69 g/mol |
| Exact Mass | 503.86 |
| IUPAC Name | 2-[1,1-dichloro-2-(1H-inden-1-id-2-yl)ethyl]-1H-inden-1-ide;zirconium |
| SMILES | ClC(Cl)(Cc1cc2ccccc2[cH-]1)c1cc2ccccc2[cH-]1.[Zr].[Zr] |
| InChI | InChI=1S/C20H14Cl2.2Zr/c21-20(22,19-11-17-7-3-4-8-18(17)12-19)13-14-9-15-5-1-2-6-16(15)10-14;;/h1-12H,13H2;;/q-2;; |
| InChIKey | GPEMGFIOGOJZEV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|