C21H29N5OS — CID 90185176
N'-[2,5-dimethyl-6-[[4-(piperidine-1-carbonyl)-1,3-thiazol-2-yl]methyl]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide (PubChem CID 90185176) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is N'-[2,5-dimethyl-6-[[4-(piperidine-1-carbonyl)-1,3-thiazol-2-yl]methyl]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[2,5-dimethyl-6-[[4-(piperidine-1-carbonyl)-1,3-thiazol-2-yl]methyl]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 90185176 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | N'-[2,5-dimethyl-6-[[4-(piperidine-1-carbonyl)-1,3-thiazol-2-yl]methyl]-3-pyridinyl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/c1cc(C)c(Cc2nc(C(=O)N3CCCCC3)cs2)nc1C |
| InChI | InChI=1S/C21H29N5OS/c1-5-25(4)14-22-18-11-15(2)17(23-16(18)3)12-20-24-19(13-28-20)21(27)26-9-7-6-8-10-26/h11,13-14H,5-10,12H2,1-4H3/b22-14+ |
| InChIKey | HEORGDRMEQWKKG-HYARGMPZSA-N |
| XLogP | 3.98 |
| TPSA | 61.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|