C37H30N2O7 — CID 90192234
3-O-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]amino]phenyl] 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate (PubChem CID 90192234) has the molecular formula C37H30N2O7 and a molecular weight of 614.65 g/mol. Its IUPAC name is 3-O-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]amino]phenyl] 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate.
| Compound Name | 3-O-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]amino]phenyl] 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 90192234 |
| Molecular Formula | C37H30N2O7 |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 3-O-[4-[[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]amino]phenyl] 1-O-(4-methylphenyl) benzene-1,3-dicarboxylate |
| SMILES | Cc1ccc(OC(=O)c2cccc(C(=O)Oc3ccc(NC(=O)c4ccc(N5C(=O)C6C7CCC(C7)C6C5=O)cc4)cc3)c2)cc1 |
| InChI | InChI=1S/C37H30N2O7/c1-21-5-15-29(16-6-21)45-36(43)25-3-2-4-26(20-25)37(44)46-30-17-11-27(12-18-30)38-33(40)22-9-13-28(14-10-22)39-34(41)31-23-7-8-24(19-23)32(31)35(39)42/h2-6,9-18,20,23-24,31-32H,7-8,19H2,1H3,(H,38,40) |
| InChIKey | BOMJHMAMDGQPSF-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|