C34H27NO6 — CID 90264240
(4-methylphenyl) 6-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]oxynaphthalene-2-carboxylate (PubChem CID 90264240) has the molecular formula C34H27NO6 and a molecular weight of 545.59 g/mol. Its IUPAC name is (4-methylphenyl) 6-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]oxynaphthalene-2-carboxylate.
| Compound Name | (4-methylphenyl) 6-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]oxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 90264240 |
| Molecular Formula | C34H27NO6 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | (4-methylphenyl) 6-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)benzoyl]oxynaphthalene-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)c2ccc3cc(OC(=O)c4ccc(N5C(=O)C6C7CCC(C7)C6C5=O)cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C34H27NO6/c1-19-2-13-27(14-3-19)40-34(39)25-7-4-22-18-28(15-10-21(22)16-25)41-33(38)20-8-11-26(12-9-20)35-31(36)29-23-5-6-24(17-23)30(29)32(35)37/h2-4,7-16,18,23-24,29-30H,5-6,17H2,1H3 |
| InChIKey | XBVRDCFRWBHKFL-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|