C66H51N5Si — CID 90195301
N-[4-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]phenyl]-4-phenyl-N-[4-(4-trimethylsilylphenyl)phenyl]aniline (PubChem CID 90195301) has the molecular formula C66H51N5Si and a molecular weight of 942.26 g/mol. Its IUPAC name is N-[4-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]phenyl]-4-phenyl-N-[4-(4-trimethylsilylphenyl)phenyl]aniline.
| Compound Name | N-[4-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]phenyl]-4-phenyl-N-[4-(4-trimethylsilylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 90195301 |
| Molecular Formula | C66H51N5Si |
| Molecular Weight | 942.26 g/mol |
| Exact Mass | 941.39 |
| IUPAC Name | N-[4-[9-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]carbazol-3-yl]phenyl]-4-phenyl-N-[4-(4-trimethylsilylphenyl)phenyl]aniline |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C66H51N5Si/c1-72(2,3)59-41-32-49(33-42-59)48-28-37-56(38-29-48)70(55-35-26-47(27-36-55)46-16-7-4-8-17-46)57-39-30-50(31-40-57)53-34-43-63-61(45-53)60-24-13-14-25-62(60)71(63)58-23-15-22-54(44-58)66-68-64(51-18-9-5-10-19-51)67-65(69-66)52-20-11-6-12-21-52/h4-45H,1-3H3 |
| InChIKey | QUMBVMDVAIYVAJ-UHFFFAOYSA-N |
| XLogP | 16.99 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.26 |
| LogP ≤ 5 | 16.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|