C63H49N3Si — CID 90195271
N,N-bis[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline (PubChem CID 90195271) has the molecular formula C63H49N3Si and a molecular weight of 876.19 g/mol. Its IUPAC name is N,N-bis[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline.
| Compound Name | N,N-bis[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline |
|---|---|
| PubChem CID | 90195271 |
| Molecular Formula | C63H49N3Si |
| Molecular Weight | 876.19 g/mol |
| Exact Mass | 875.37 |
| IUPAC Name | N,N-bis[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(N(c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C63H49N3Si/c1-67(2,3)55-38-28-45(29-39-55)44-22-32-52(33-23-44)64(53-34-24-46(25-35-53)48-30-40-62-58(42-48)56-18-10-12-20-60(56)65(62)50-14-6-4-7-15-50)54-36-26-47(27-37-54)49-31-41-63-59(43-49)57-19-11-13-21-61(57)66(63)51-16-8-5-9-17-51/h4-43H,1-3H3 |
| InChIKey | ZKWJATYTXPGNBT-UHFFFAOYSA-N |
| XLogP | 16.90 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.19 |
| LogP ≤ 5 | 16.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|