C59H44N2S2Si — CID 90195306
N-[4-([1]benzothiolo[3,2-b][1]benzothiol-2-yl)phenyl]-N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline (PubChem CID 90195306) has the molecular formula C59H44N2S2Si and a molecular weight of 873.24 g/mol. Its IUPAC name is N-[4-([1]benzothiolo[3,2-b][1]benzothiol-2-yl)phenyl]-N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline.
| Compound Name | N-[4-([1]benzothiolo[3,2-b][1]benzothiol-2-yl)phenyl]-N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline |
|---|---|
| PubChem CID | 90195306 |
| Molecular Formula | C59H44N2S2Si |
| Molecular Weight | 873.24 g/mol |
| Exact Mass | 872.27 |
| IUPAC Name | N-[4-([1]benzothiolo[3,2-b][1]benzothiol-2-yl)phenyl]-N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)aniline |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(N(c3ccc(-c4ccc5c(c4)sc4c6ccccc6sc54)cc3)c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C59H44N2S2Si/c1-64(2,3)49-33-23-40(24-34-49)39-17-27-46(28-18-39)60(48-31-21-42(22-32-48)44-25-35-52-57(38-44)63-58-51-14-8-10-16-56(51)62-59(52)58)47-29-19-41(20-30-47)43-26-36-55-53(37-43)50-13-7-9-15-54(50)61(55)45-11-5-4-6-12-45/h4-38H,1-3H3 |
| InChIKey | NVPZMDVCXADHBT-UHFFFAOYSA-N |
| XLogP | 17.38 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.24 |
| LogP ≤ 5 | 17.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|