C69H56N2Si2 — CID 90195243
N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]aniline (PubChem CID 90195243) has the molecular formula C69H56N2Si2 and a molecular weight of 969.39 g/mol. Its IUPAC name is N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]aniline.
| Compound Name | N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]aniline |
|---|---|
| PubChem CID | 90195243 |
| Molecular Formula | C69H56N2Si2 |
| Molecular Weight | 969.39 g/mol |
| Exact Mass | 968.40 |
| IUPAC Name | N-[4-(9-phenylcarbazol-3-yl)phenyl]-4-(4-trimethylsilylphenyl)-N-[4-(4-triphenylsilylphenyl)phenyl]aniline |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc(N(c3ccc(-c4ccc([Si](c5ccccc5)(c5ccccc5)c5ccccc5)cc4)cc3)c3ccc(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C69H56N2Si2/c1-72(2,3)61-45-34-53(35-46-61)51-28-39-58(40-29-51)70(60-43-32-55(33-44-60)56-38-49-69-67(50-56)66-26-16-17-27-68(66)71(69)57-18-8-4-9-19-57)59-41-30-52(31-42-59)54-36-47-65(48-37-54)73(62-20-10-5-11-21-62,63-22-12-6-13-23-63)64-24-14-7-15-25-64/h4-50H,1-3H3 |
| InChIKey | AEOVKADYESKXRP-UHFFFAOYSA-N |
| XLogP | 15.18 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.39 |
| LogP ≤ 5 | 15.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|