C10H12F2O4S — CID 90199677
2,5-difluoro-4-(3-methylsulfonylpropoxy)phenol (PubChem CID 90199677) has the molecular formula C10H12F2O4S and a molecular weight of 266.26 g/mol. Its IUPAC name is 2,5-difluoro-4-(3-methylsulfonylpropoxy)phenol.
| Compound Name | 2,5-difluoro-4-(3-methylsulfonylpropoxy)phenol |
|---|---|
| PubChem CID | 90199677 |
| Molecular Formula | C10H12F2O4S |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2,5-difluoro-4-(3-methylsulfonylpropoxy)phenol |
| SMILES | CS(=O)(=O)CCCOc1cc(F)c(O)cc1F |
| InChI | InChI=1S/C10H12F2O4S/c1-17(14,15)4-2-3-16-10-6-7(11)9(13)5-8(10)12/h5-6,13H,2-4H2,1H3 |
| InChIKey | XEHXREZAGKCSIG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|