C16H14N2O2 — CID 90202469
3-[4-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]-1,2-oxazole (PubChem CID 90202469) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-[4-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]-1,2-oxazole.
| Compound Name | 3-[4-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 90202469 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 3-[4-[(2-methyl-3-pyridinyl)oxymethyl]phenyl]-1,2-oxazole |
| SMILES | Cc1ncccc1OCc1ccc(-c2ccon2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c1-12-16(3-2-9-17-12)19-11-13-4-6-14(7-5-13)15-8-10-20-18-15/h2-10H,11H2,1H3 |
| InChIKey | HYMOIGJNGVRADX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |