C12H18O20P2 — CID 90205726
2-hydroxy-2-(2-oxo-2-phosphonooxyethyl)butanedioic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid (PubChem CID 90205726) has the molecular formula C12H18O20P2 and a molecular weight of 544.20 g/mol. Its IUPAC name is 2-hydroxy-2-(2-oxo-2-phosphonooxyethyl)butanedioic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-2-(2-oxo-2-phosphonooxyethyl)butanedioic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 90205726 |
| Molecular Formula | C12H18O20P2 |
| Molecular Weight | 544.20 g/mol |
| Exact Mass | 543.99 |
| IUPAC Name | 2-hydroxy-2-(2-oxo-2-phosphonooxyethyl)butanedioic acid;2-phosphonooxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(CC(=O)O)(OP(=O)(O)O)C(=O)O.O=C(O)CC(O)(CC(=O)OP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/2C6H9O10P/c7-3(8)1-6(12,5(10)11)2-4(9)16-17(13,14)15;7-3(8)1-6(5(11)12,2-4(9)10)16-17(13,14)15/h12H,1-2H2,(H,7,8)(H,10,11)(H2,13,14,15);1-2H2,(H,7,8)(H,9,10)(H,11,12)(H2,13,14,15) |
| InChIKey | VYLWBXOKCJPVCI-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 357.32 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.20 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|