C12H17BN3O2 — CID 90210869
CID 90210869 (PubChem CID 90210869) has the molecular formula C12H17BN3O2 and a molecular weight of 246.10 g/mol.
| Compound Name | CID 90210869 |
|---|---|
| PubChem CID | 90210869 |
| Molecular Formula | C12H17BN3O2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | — |
| SMILES | CC(C)(O)C(C)(C)O[B]c1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C12H17BN3O2/c1-11(2,17)12(3,4)18-13-9-5-8-6-15-16-10(8)14-7-9/h5-7,17H,1-4H3,(H,14,15,16) |
| InChIKey | BOIADVHYYBYCIR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|