C28H31FN2O3Si — CID 90213577
[4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[5-[2-(2-fluorophenyl)ethynyl]-3-[[hydroxy(dimethyl)silyl]methyl]furan-2-yl]methanone (PubChem CID 90213577) has the molecular formula C28H31FN2O3Si and a molecular weight of 490.65 g/mol. Its IUPAC name is [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[5-[2-(2-fluorophenyl)ethynyl]-3-[[hydroxy(dimethyl)silyl]methyl]furan-2-yl]methanone.
| Compound Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[5-[2-(2-fluorophenyl)ethynyl]-3-[[hydroxy(dimethyl)silyl]methyl]furan-2-yl]methanone |
|---|---|
| PubChem CID | 90213577 |
| Molecular Formula | C28H31FN2O3Si |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [4-[3-(aminomethyl)phenyl]piperidin-1-yl]-[5-[2-(2-fluorophenyl)ethynyl]-3-[[hydroxy(dimethyl)silyl]methyl]furan-2-yl]methanone |
| SMILES | C[Si](C)(O)Cc1cc(C#Cc2ccccc2F)oc1C(=O)N1CCC(c2cccc(CN)c2)CC1 |
| InChI | InChI=1S/C28H31FN2O3Si/c1-35(2,33)19-24-17-25(11-10-22-7-3-4-9-26(22)29)34-27(24)28(32)31-14-12-21(13-15-31)23-8-5-6-20(16-23)18-30/h3-9,16-17,21,33H,12-15,18-19,30H2,1-2H3 |
| InChIKey | ANIIPJVWUQINLW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|