C29H21ClF3NO6 — CID 90214678
4-[4-[3-[4-(4-carboxyoxyphenyl)-2-chlorophenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]benzoic acid (PubChem CID 90214678) has the molecular formula C29H21ClF3NO6 and a molecular weight of 571.94 g/mol. Its IUPAC name is 4-[4-[3-[4-(4-carboxyoxyphenyl)-2-chlorophenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]benzoic acid.
| Compound Name | 4-[4-[3-[4-(4-carboxyoxyphenyl)-2-chlorophenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 90214678 |
| Molecular Formula | C29H21ClF3NO6 |
| Molecular Weight | 571.94 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | 4-[4-[3-[4-(4-carboxyoxyphenyl)-2-chlorophenyl]-1,1,1-trifluoro-2-hydroxybutan-2-yl]-2-pyridinyl]benzoic acid |
| SMILES | CC(c1ccc(-c2ccc(OC(=O)O)cc2)cc1Cl)C(O)(c1ccnc(-c2ccc(C(=O)O)cc2)c1)C(F)(F)F |
| InChI | InChI=1S/C29H21ClF3NO6/c1-16(23-11-8-20(14-24(23)30)17-6-9-22(10-7-17)40-27(37)38)28(39,29(31,32)33)21-12-13-34-25(15-21)18-2-4-19(5-3-18)26(35)36/h2-16,39H,1H3,(H,35,36)(H,37,38) |
| InChIKey | HOLCXMQYEYZNAV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.94 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|