C28H33FN4O5S — CID 90217022
6-[[4-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]cyclohexyl]sulfamoyl]-N-(2-methoxyethyl)quinoline-2-carboxamide (PubChem CID 90217022) has the molecular formula C28H33FN4O5S and a molecular weight of 556.66 g/mol. Its IUPAC name is 6-[[4-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]cyclohexyl]sulfamoyl]-N-(2-methoxyethyl)quinoline-2-carboxamide.
| Compound Name | 6-[[4-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]cyclohexyl]sulfamoyl]-N-(2-methoxyethyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 90217022 |
| Molecular Formula | C28H33FN4O5S |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.22 |
| IUPAC Name | 6-[[4-[[(1R)-1-(4-fluorophenyl)ethyl]carbamoyl]cyclohexyl]sulfamoyl]-N-(2-methoxyethyl)quinoline-2-carboxamide |
| SMILES | COCCNC(=O)c1ccc2cc(S(=O)(=O)NC3CCC(C(=O)N[C@H](C)c4ccc(F)cc4)CC3)ccc2n1 |
| InChI | InChI=1S/C28H33FN4O5S/c1-18(19-3-8-22(29)9-4-19)31-27(34)20-5-10-23(11-6-20)33-39(36,37)24-12-14-25-21(17-24)7-13-26(32-25)28(35)30-15-16-38-2/h3-4,7-9,12-14,17-18,20,23,33H,5-6,10-11,15-16H2,1-2H3,(H,30,35)(H,31,34)/t18-,20?,23?/m1/s1 |
| InChIKey | HOZQWKWZSFLBQF-TWEIKEKHSA-N |
| XLogP | 3.46 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|