C13H14BN4O2 — CID 90217848
CID 90217848 (PubChem CID 90217848) has the molecular formula C13H14BN4O2 and a molecular weight of 269.09 g/mol.
| Compound Name | CID 90217848 |
|---|---|
| PubChem CID | 90217848 |
| Molecular Formula | C13H14BN4O2 |
| Molecular Weight | 269.09 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | — |
| SMILES | CCn1cnc2c(-c3ccccc3)cnnc21.O[B]O |
| InChI | InChI=1S/C13H12N4.BH2O2/c1-2-17-9-14-12-11(8-15-16-13(12)17)10-6-4-3-5-7-10;2-1-3/h3-9H,2H2,1H3;2-3H |
| InChIKey | ZHONUGJRUYYVHY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.09 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|