C22H30F2NO3PS — CID 90218506
3-[[2-fluoro-4-[5-(4-fluorophenyl)pentylsulfanyl]-5-methylphenyl]methylamino]propylphosphonic acid (PubChem CID 90218506) has the molecular formula C22H30F2NO3PS and a molecular weight of 457.52 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[5-(4-fluorophenyl)pentylsulfanyl]-5-methylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2-fluoro-4-[5-(4-fluorophenyl)pentylsulfanyl]-5-methylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218506 |
| Molecular Formula | C22H30F2NO3PS |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 3-[[2-fluoro-4-[5-(4-fluorophenyl)pentylsulfanyl]-5-methylphenyl]methylamino]propylphosphonic acid |
| SMILES | Cc1cc(CNCCCP(=O)(O)O)c(F)cc1SCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C22H30F2NO3PS/c1-17-14-19(16-25-11-5-12-29(26,27)28)21(24)15-22(17)30-13-4-2-3-6-18-7-9-20(23)10-8-18/h7-10,14-15,25H,2-6,11-13,16H2,1H3,(H2,26,27,28) |
| InChIKey | HQDJJUGWTIZZPB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|