C21H29FNO3PS — CID 90218228
3-[[3-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218228) has the molecular formula C21H29FNO3PS and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[[3-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218228 |
| Molecular Formula | C21H29FNO3PS |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-[[3-fluoro-4-(5-phenylpentylsulfanyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C21H29FNO3PS/c22-20-16-19(17-23-13-7-14-27(24,25)26)11-12-21(20)28-15-6-2-5-10-18-8-3-1-4-9-18/h1,3-4,8-9,11-12,16,23H,2,5-7,10,13-15,17H2,(H2,24,25,26) |
| InChIKey | SRHHSHBZKVPVMH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|