C23H31FNO4PS — CID 90218383
3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 90218383) has the molecular formula C23H31FNO4PS and a molecular weight of 467.54 g/mol. Its IUPAC name is 3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218383 |
| Molecular Formula | C23H31FNO4PS |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 3-[[4-[4-[3-(2-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1ccc(SCCCCC2(c3ccccc3F)COC2)cc1 |
| InChI | InChI=1S/C23H31FNO4PS/c24-22-7-2-1-6-21(22)23(17-29-18-23)12-3-4-15-31-20-10-8-19(9-11-20)16-25-13-5-14-30(26,27)28/h1-2,6-11,25H,3-5,12-18H2,(H2,26,27,28) |
| InChIKey | MABRIYCYATVOQK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|