C24H30F4NO4PS — CID 90218161
3-[[2-fluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218161) has the molecular formula C24H30F4NO4PS and a molecular weight of 535.54 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2-fluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218161 |
| Molecular Formula | C24H30F4NO4PS |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 3-[[2-fluoro-4-[4-(3-phenyloxetan-3-yl)butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(C(F)(F)F)c(SCCCCC2(c3ccccc3)COC2)cc1F |
| InChI | InChI=1S/C24H30F4NO4PS/c25-21-14-22(20(24(26,27)28)13-18(21)15-29-10-6-11-34(30,31)32)35-12-5-4-9-23(16-33-17-23)19-7-2-1-3-8-19/h1-3,7-8,13-14,29H,4-6,9-12,15-17H2,(H2,30,31,32) |
| InChIKey | IPPXYXATPCQYTG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|