C24H32F4NO3PS — CID 90218431
3-[[4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-3-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218431) has the molecular formula C24H32F4NO3PS and a molecular weight of 521.56 g/mol. Its IUPAC name is 3-[[4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-3-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-3-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218431 |
| Molecular Formula | C24H32F4NO3PS |
| Molecular Weight | 521.56 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 3-[[4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanyl-3-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | CC(C)(CCCCSc1ccc(CNCCCP(=O)(O)O)cc1C(F)(F)F)c1ccccc1F |
| InChI | InChI=1S/C24H32F4NO3PS/c1-23(2,19-8-3-4-9-21(19)25)12-5-6-15-34-22-11-10-18(16-20(22)24(26,27)28)17-29-13-7-14-33(30,31)32/h3-4,8-11,16,29H,5-7,12-15,17H2,1-2H3,(H2,30,31,32) |
| InChIKey | OXMSJQYHGGOWDL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|