C24H29F5NO4PS — CID 90218188
3-[[2-fluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid (PubChem CID 90218188) has the molecular formula C24H29F5NO4PS and a molecular weight of 553.53 g/mol. Its IUPAC name is 3-[[2-fluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2-fluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218188 |
| Molecular Formula | C24H29F5NO4PS |
| Molecular Weight | 553.53 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 3-[[2-fluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]-5-(trifluoromethyl)phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(C(F)(F)F)c(SCCCCC2(c3ccc(F)cc3)COC2)cc1F |
| InChI | InChI=1S/C24H29F5NO4PS/c25-19-6-4-18(5-7-19)23(15-34-16-23)8-1-2-11-36-22-13-21(26)17(12-20(22)24(27,28)29)14-30-9-3-10-35(31,32)33/h4-7,12-13,30H,1-3,8-11,14-16H2,(H2,31,32,33) |
| InChIKey | JXBKSYJBMXGQIY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|