C23H29F3NO4PS — CID 90218489
3-[[2,5-difluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid (PubChem CID 90218489) has the molecular formula C23H29F3NO4PS and a molecular weight of 503.52 g/mol. Its IUPAC name is 3-[[2,5-difluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[2,5-difluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218489 |
| Molecular Formula | C23H29F3NO4PS |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 3-[[2,5-difluoro-4-[4-[3-(4-fluorophenyl)oxetan-3-yl]butylsulfanyl]phenyl]methylamino]propylphosphonic acid |
| SMILES | O=P(O)(O)CCCNCc1cc(F)c(SCCCCC2(c3ccc(F)cc3)COC2)cc1F |
| InChI | InChI=1S/C23H29F3NO4PS/c24-19-6-4-18(5-7-19)23(15-31-16-23)8-1-2-11-33-22-13-20(25)17(12-21(22)26)14-27-9-3-10-32(28,29)30/h4-7,12-13,27H,1-3,8-11,14-16H2,(H2,28,29,30) |
| InChIKey | TVUGIJIDQKLVFY-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|