C23H32F2NO3PS — CID 90218458
3-[[3-fluoro-4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propylphosphonic acid (PubChem CID 90218458) has the molecular formula C23H32F2NO3PS and a molecular weight of 471.55 g/mol. Its IUPAC name is 3-[[3-fluoro-4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propylphosphonic acid.
| Compound Name | 3-[[3-fluoro-4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propylphosphonic acid |
|---|---|
| PubChem CID | 90218458 |
| Molecular Formula | C23H32F2NO3PS |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-[[3-fluoro-4-[5-(2-fluorophenyl)-5-methylhexyl]sulfanylphenyl]methylamino]propylphosphonic acid |
| SMILES | CC(C)(CCCCSc1ccc(CNCCCP(=O)(O)O)cc1F)c1ccccc1F |
| InChI | InChI=1S/C23H32F2NO3PS/c1-23(2,19-8-3-4-9-20(19)24)12-5-6-15-31-22-11-10-18(16-21(22)25)17-26-13-7-14-30(27,28)29/h3-4,8-11,16,26H,5-7,12-15,17H2,1-2H3,(H2,27,28,29) |
| InChIKey | IHHDZVOGBRPVIE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|