C31H54N10O4 — CID 90219206
tert-butyl 4-[6-(2H-triazol-4-yl)hexanoylamino]piperidine-1-carboxylate;N-piperidin-4-yl-6-(2H-triazol-4-yl)hexanamide (PubChem CID 90219206) has the molecular formula C31H54N10O4 and a molecular weight of 630.84 g/mol. Its IUPAC name is tert-butyl 4-[6-(2H-triazol-4-yl)hexanoylamino]piperidine-1-carboxylate;N-piperidin-4-yl-6-(2H-triazol-4-yl)hexanamide.
| Compound Name | tert-butyl 4-[6-(2H-triazol-4-yl)hexanoylamino]piperidine-1-carboxylate;N-piperidin-4-yl-6-(2H-triazol-4-yl)hexanamide |
|---|---|
| PubChem CID | 90219206 |
| Molecular Formula | C31H54N10O4 |
| Molecular Weight | 630.84 g/mol |
| Exact Mass | 630.43 |
| IUPAC Name | tert-butyl 4-[6-(2H-triazol-4-yl)hexanoylamino]piperidine-1-carboxylate;N-piperidin-4-yl-6-(2H-triazol-4-yl)hexanamide |
| SMILES | CC(C)(C)OC(=O)N1CCC(NC(=O)CCCCCc2cn[nH]n2)CC1.O=C(CCCCCc1cn[nH]n1)NC1CCNCC1 |
| InChI | InChI=1S/C18H31N5O3.C13H23N5O/c1-18(2,3)26-17(25)23-11-9-14(10-12-23)20-16(24)8-6-4-5-7-15-13-19-22-21-15;19-13(16-11-6-8-14-9-7-11)5-3-1-2-4-12-10-15-18-17-12/h13-14H,4-12H2,1-3H3,(H,20,24)(H,19,21,22);10-11,14H,1-9H2,(H,16,19)(H,15,17,18) |
| InChIKey | IQSURKOUQZWRGO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 182.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|