C36H43F3N6O8S — CID 90224868
tert-butyl 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate (PubChem CID 90224868) has the molecular formula C36H43F3N6O8S and a molecular weight of 776.84 g/mol. Its IUPAC name is tert-butyl 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 90224868 |
| Molecular Formula | C36H43F3N6O8S |
| Molecular Weight | 776.84 g/mol |
| Exact Mass | 776.28 |
| IUPAC Name | tert-butyl 1-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-2,4-dioxo-1,3,8-triazaspiro[4.5]decane-8-carboxylate |
| SMILES | Cc1cc(N2C(=O)NC(=O)C23CCN(C(=O)OC(C)(C)C)CC3)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(c1ccc(OC(F)(F)F)cc1)NC2=O |
| InChI | InChI=1S/C36H43F3N6O8S/c1-22-20-25(45-31(48)41-30(47)35(45)13-15-43(16-14-35)32(49)53-33(3,4)5)21-23(2)27(22)10-19-54(50,51)44-17-11-34(12-18-44)29(46)40-28(42-34)24-6-8-26(9-7-24)52-36(37,38)39/h6-9,20-21H,10-19H2,1-5H3,(H,40,42,46)(H,41,47,48) |
| InChIKey | GKNNZGQYASDADH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.84 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|