C32H39F3N6O6S — CID 144644706
3-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1,3,7-triazacycloundecane-2,11-dione (PubChem CID 144644706) has the molecular formula C32H39F3N6O6S and a molecular weight of 692.76 g/mol. Its IUPAC name is 3-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1,3,7-triazacycloundecane-2,11-dione.
| Compound Name | 3-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1,3,7-triazacycloundecane-2,11-dione |
|---|---|
| PubChem CID | 144644706 |
| Molecular Formula | C32H39F3N6O6S |
| Molecular Weight | 692.76 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 3-[3,5-dimethyl-4-[2-[[4-oxo-2-[4-(trifluoromethoxy)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]phenyl]-1,3,7-triazacycloundecane-2,11-dione |
| SMILES | Cc1cc(N2CCCNCCCC(=O)NC2=O)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(c1ccc(OC(F)(F)F)cc1)NC2=O |
| InChI | InChI=1S/C32H39F3N6O6S/c1-21-19-24(41-15-4-14-36-13-3-5-27(42)37-30(41)44)20-22(2)26(21)10-18-48(45,46)40-16-11-31(12-17-40)29(43)38-28(39-31)23-6-8-25(9-7-23)47-32(33,34)35/h6-9,19-20,36H,3-5,10-18H2,1-2H3,(H,37,42,44)(H,38,39,43) |
| InChIKey | GRUQIGPZYQRZOU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 149.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |