C31H38N6O6S — CID 137014816
1-[4-[2-[[2-(4-hydroxyphenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3,5-dimethylphenyl]-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 137014816) has the molecular formula C31H38N6O6S and a molecular weight of 622.75 g/mol. Its IUPAC name is 1-[4-[2-[[2-(4-hydroxyphenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3,5-dimethylphenyl]-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-[4-[2-[[2-(4-hydroxyphenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3,5-dimethylphenyl]-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 137014816 |
| Molecular Formula | C31H38N6O6S |
| Molecular Weight | 622.75 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | 1-[4-[2-[[2-(4-hydroxyphenyl)-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethyl]-3,5-dimethylphenyl]-8-methyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1cc(N2C(=O)NC(=O)C23CCN(C)CC3)cc(C)c1CCS(=O)(=O)N1CCC2(CC1)N=C(c1ccc(O)cc1)NC2=O |
| InChI | InChI=1S/C31H38N6O6S/c1-20-18-23(37-29(41)33-28(40)31(37)11-13-35(3)14-12-31)19-21(2)25(20)8-17-44(42,43)36-15-9-30(10-16-36)27(39)32-26(34-30)22-4-6-24(38)7-5-22/h4-7,18-19,38H,8-17H2,1-3H3,(H,32,34,39)(H,33,40,41) |
| InChIKey | ATZGOMGQWQPONH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.75 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|