C22H22N4O2S — CID 90226323
N-(2-methoxy-5-morpholin-4-ylphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-3-amine (PubChem CID 90226323) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-3-amine.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 90226323 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylphenyl)-4-thiophen-3-yl-1H-pyrrolo[2,3-b]pyridin-3-amine |
| SMILES | COc1ccc(N2CCOCC2)cc1Nc1c[nH]c2nccc(-c3ccsc3)c12 |
| InChI | InChI=1S/C22H22N4O2S/c1-27-20-3-2-16(26-7-9-28-10-8-26)12-18(20)25-19-13-24-22-21(19)17(4-6-23-22)15-5-11-29-14-15/h2-6,11-14,25H,7-10H2,1H3,(H,23,24) |
| InChIKey | VVNJTNGOXKNPPC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|