C26H26N4O4 — CID 58087558
(3,5-dimethoxyphenyl)-[4-(4-morpholin-4-ylanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone (PubChem CID 58087558) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-[4-(4-morpholin-4-ylanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone.
| Compound Name | (3,5-dimethoxyphenyl)-[4-(4-morpholin-4-ylanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
|---|---|
| PubChem CID | 58087558 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (3,5-dimethoxyphenyl)-[4-(4-morpholin-4-ylanilino)-1H-pyrrolo[2,3-b]pyridin-3-yl]methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2c[nH]c3nccc(Nc4ccc(N5CCOCC5)cc4)c23)c1 |
| InChI | InChI=1S/C26H26N4O4/c1-32-20-13-17(14-21(15-20)33-2)25(31)22-16-28-26-24(22)23(7-8-27-26)29-18-3-5-19(6-4-18)30-9-11-34-12-10-30/h3-8,13-16H,9-12H2,1-2H3,(H2,27,28,29) |
| InChIKey | ZSPXUIGSXBWGMI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|