About 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine
4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine (PubChem CID 90226325) has the molecular formula C18H14ClN3OS
and a molecular weight of 355.85 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 90226325 |
| Molecular Formula | C18H14ClN3OS |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine |
| SMILES | CCOc1ccccc1-c1[nH]nc2nccc(-c3ccc(Cl)s3)c12 |
| InChI | InChI=1S/C18H14ClN3OS/c1-2-23-13-6-4-3-5-11(13)17-16-12(14-7-8-15(19)24-14)9-10-20-18(16)22-21-17/h3-10H,2H2,1H3,(H,20,21,22) |
| InChIKey | FSZKCBULFOCDQN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine (CID 90226325) is 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine is CCOc1ccccc1-c1[nH]nc2nccc(-c3ccc(Cl)s3)c12.
What is the InChIKey of 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
The InChIKey is FSZKCBULFOCDQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3OS/c1-2-23-13-6-4-3-5-11(13)17-16-12(14-7-8-15(19)24-14)9-10-20-18(16)22-21-17/h3-10H,2H2,1H3,(H,20,21,22).
What are the key properties of 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine?
4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine has a molecular weight of 355.85 g/mol, XLogP of 5.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 90226325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).