C27H35F4NO3PS+ — CID 90227442
3-[[4-[4-[1-(4-fluorophenyl)cyclohexyl]butylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium (PubChem CID 90227442) has the molecular formula C27H35F4NO3PS+ and a molecular weight of 560.61 g/mol. Its IUPAC name is 3-[[4-[4-[1-(4-fluorophenyl)cyclohexyl]butylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium.
| Compound Name | 3-[[4-[4-[1-(4-fluorophenyl)cyclohexyl]butylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 90227442 |
| Molecular Formula | C27H35F4NO3PS+ |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | 3-[[4-[4-[1-(4-fluorophenyl)cyclohexyl]butylsulfanyl]-3-(trifluoromethyl)phenyl]methylamino]propoxy-hydroxy-oxophosphanium |
| SMILES | O=[P+](O)OCCCNCc1ccc(SCCCCC2(c3ccc(F)cc3)CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H34F4NO3PS/c28-23-10-8-22(9-11-23)26(13-2-1-3-14-26)15-4-5-18-37-25-12-7-21(19-24(25)27(29,30)31)20-32-16-6-17-35-36(33)34/h7-12,19,32H,1-6,13-18,20H2/p+1 |
| InChIKey | XPVOIYYZMWDDAT-UHFFFAOYSA-O |
| XLogP | 8.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|