C19H15N3 — CID 90231130
4-(4-pyridin-2-ylphenyl)-1,4-dihydroquinazoline (PubChem CID 90231130) has the molecular formula C19H15N3 and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(4-pyridin-2-ylphenyl)-1,4-dihydroquinazoline.
| Compound Name | 4-(4-pyridin-2-ylphenyl)-1,4-dihydroquinazoline |
|---|---|
| PubChem CID | 90231130 |
| Molecular Formula | C19H15N3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 4-(4-pyridin-2-ylphenyl)-1,4-dihydroquinazoline |
| SMILES | C1=NC(c2ccc(-c3ccccn3)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C19H15N3/c1-2-7-18-16(5-1)19(22-13-21-18)15-10-8-14(9-11-15)17-6-3-4-12-20-17/h1-13,19H,(H,21,22) |
| InChIKey | JJAKFEWRWVMFJU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |