C14H17F2NO — CID 90236000
4-benzyl-5,5-difluoro-2,3,4a,6,7,7a-hexahydrocyclopenta[b][1,4]oxazine (PubChem CID 90236000) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 4-benzyl-5,5-difluoro-2,3,4a,6,7,7a-hexahydrocyclopenta[b][1,4]oxazine.
| Compound Name | 4-benzyl-5,5-difluoro-2,3,4a,6,7,7a-hexahydrocyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 90236000 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 4-benzyl-5,5-difluoro-2,3,4a,6,7,7a-hexahydrocyclopenta[b][1,4]oxazine |
| SMILES | FC1(F)CCC2OCCN(Cc3ccccc3)C21 |
| InChI | InChI=1S/C14H17F2NO/c15-14(16)7-6-12-13(14)17(8-9-18-12)10-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2 |
| InChIKey | FZPDSXWJZIGXDH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |